About potassium pent-4-en-2-olate
potassium pent-4-en-2-olate (PubChem CID 143030421) has the molecular formula C5H9KO
and a molecular weight of 124.22 g/mol. Its IUPAC name is potassium pent-4-en-2-olate.
Molecular Properties
| Compound Name | potassium pent-4-en-2-olate |
| PubChem CID | 143030421 |
| Molecular Formula | C5H9KO |
| Molecular Weight | 124.22 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | potassium pent-4-en-2-olate |
| SMILES | C=CCC(C)[O-].[K+] |
| InChI | InChI=1S/C5H9O.K/c1-3-4-5(2)6;/h3,5H,1,4H2,2H3;/q-1;+1 |
| InChIKey | KNKZJKNBHFEHEX-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.22 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium pent-4-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium pent-4-en-2-olate?
The IUPAC name of potassium pent-4-en-2-olate (CID 143030421) is potassium pent-4-en-2-olate.
What is the SMILES notation for potassium pent-4-en-2-olate?
The canonical SMILES for potassium pent-4-en-2-olate is C=CCC(C)[O-].[K+].
What is the InChIKey of potassium pent-4-en-2-olate?
The InChIKey is KNKZJKNBHFEHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O.K/c1-3-4-5(2)6;/h3,5H,1,4H2,2H3;/q-1;+1.
What are the key properties of potassium pent-4-en-2-olate?
potassium pent-4-en-2-olate has a molecular weight of 124.22 g/mol, XLogP of -2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium pent-4-en-2-olate is sourced from PubChem (CID 143030421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).