C9H10O2 — CID 10374605
hexa-1,5-dien-3-yl prop-2-ynoate (PubChem CID 10374605) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is hexa-1,5-dien-3-yl prop-2-ynoate.
| Compound Name | hexa-1,5-dien-3-yl prop-2-ynoate |
|---|---|
| PubChem CID | 10374605 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | hexa-1,5-dien-3-yl prop-2-ynoate |
| SMILES | C#CC(=O)OC(C=C)CC=C |
| InChI | InChI=1S/C9H10O2/c1-4-7-8(5-2)11-9(10)6-3/h3-5,8H,1-2,7H2 |
| InChIKey | ZYBMWHNOUZEBTE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|