C10H14O2 — CID 15319642
hepta-1,6-dien-3-yl prop-2-enoate (PubChem CID 15319642) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is hepta-1,6-dien-3-yl prop-2-enoate.
| Compound Name | hepta-1,6-dien-3-yl prop-2-enoate |
|---|---|
| PubChem CID | 15319642 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | hepta-1,6-dien-3-yl prop-2-enoate |
| SMILES | C=CCCC(C=C)OC(=O)C=C |
| InChI | InChI=1S/C10H14O2/c1-4-7-8-9(5-2)12-10(11)6-3/h4-6,9H,1-3,7-8H2 |
| InChIKey | RQFUSNITTPPWLU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|