About 4-bromodeca-1,8-diene
4-bromodeca-1,8-diene (PubChem CID 150882644) has the molecular formula C10H17Br
and a molecular weight of 217.15 g/mol. Its IUPAC name is 4-bromodeca-1,8-diene.
Molecular Properties
| Compound Name | 4-bromodeca-1,8-diene |
| PubChem CID | 150882644 |
| Molecular Formula | C10H17Br |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-bromodeca-1,8-diene |
| SMILES | C=CCC(Br)CCCC=CC |
| InChI | InChI=1S/C10H17Br/c1-3-5-6-7-9-10(11)8-4-2/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | KWIOHXBECZCHRF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromodeca-1,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromodeca-1,8-diene?
The IUPAC name of 4-bromodeca-1,8-diene (CID 150882644) is 4-bromodeca-1,8-diene.
What is the SMILES notation for 4-bromodeca-1,8-diene?
The canonical SMILES for 4-bromodeca-1,8-diene is C=CCC(Br)CCCC=CC.
What is the InChIKey of 4-bromodeca-1,8-diene?
The InChIKey is KWIOHXBECZCHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Br/c1-3-5-6-7-9-10(11)8-4-2/h3-5,10H,2,6-9H2,1H3.
What are the key properties of 4-bromodeca-1,8-diene?
4-bromodeca-1,8-diene has a molecular weight of 217.15 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromodeca-1,8-diene is sourced from PubChem (CID 150882644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).