C13H20 — CID 123717396
4-methyldodeca-1,6,8,10-tetraene (PubChem CID 123717396) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 4-methyldodeca-1,6,8,10-tetraene.
| Compound Name | 4-methyldodeca-1,6,8,10-tetraene |
|---|---|
| PubChem CID | 123717396 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 4-methyldodeca-1,6,8,10-tetraene |
| SMILES | C=CCC(C)CC=CC=CC=CC |
| InChI | InChI=1S/C13H20/c1-4-6-7-8-9-10-12-13(3)11-5-2/h4-10,13H,2,11-12H2,1,3H3 |
| InChIKey | DITQUBDHUBIJGA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|