C28H42 — CID 161078348
(3E,7Z,9Z)-5,5-dimethylundeca-1,3,7,9-tetraene;ethene;(3Z,5E)-8-ethenylundeca-1,3,5,10-tetraene (PubChem CID 161078348) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is (3E,7Z,9Z)-5,5-dimethylundeca-1,3,7,9-tetraene;ethene;(3Z,5E)-8-ethenylundeca-1,3,5,10-tetraene.
| Compound Name | (3E,7Z,9Z)-5,5-dimethylundeca-1,3,7,9-tetraene;ethene;(3Z,5E)-8-ethenylundeca-1,3,5,10-tetraene |
|---|---|
| PubChem CID | 161078348 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | (3E,7Z,9Z)-5,5-dimethylundeca-1,3,7,9-tetraene;ethene;(3Z,5E)-8-ethenylundeca-1,3,5,10-tetraene |
| SMILES | C=C.C=C/C=C/C(C)(C)C/C=C\C=C/C.C=C/C=C\C=C\CC(C=C)CC=C |
| InChI | InChI=1S/C13H20.C13H18.C2H4/c1-5-7-9-10-12-13(3,4)11-8-6-2;1-4-7-8-9-10-12-13(6-3)11-5-2;1-2/h5-11H,2,12H2,1,3-4H3;4-10,13H,1-3,11-12H2;1-2H2/b7-5-,10-9-,11-8+;8-7-,10-9+; |
| InChIKey | UFORQGVYRRUKBM-PIJMYVGTSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|