C15H28NOP — CID 15252639
N-[[(2E,4E)-hexa-2,4-dienyl]-prop-2-enylphosphoryl]-N-propan-2-ylpropan-2-amine (PubChem CID 15252639) has the molecular formula C15H28NOP and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[[(2E,4E)-hexa-2,4-dienyl]-prop-2-enylphosphoryl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[(2E,4E)-hexa-2,4-dienyl]-prop-2-enylphosphoryl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 15252639 |
| Molecular Formula | C15H28NOP |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N-[[(2E,4E)-hexa-2,4-dienyl]-prop-2-enylphosphoryl]-N-propan-2-ylpropan-2-amine |
| SMILES | C=CCP(=O)(C/C=C/C=C/C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28NOP/c1-7-9-10-11-13-18(17,12-8-2)16(14(3)4)15(5)6/h7-11,14-15H,2,12-13H2,1,3-6H3/b9-7+,11-10+ |
| InChIKey | WVKSYSMVDYGGLF-RJECPTDASA-N |
| XLogP | 4.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|