C14H26BrNS — CID 171086406
(2E)-4-bromo-N-tert-butylsulfanyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane (PubChem CID 171086406) has the molecular formula C14H26BrNS and a molecular weight of 320.34 g/mol. Its IUPAC name is (2E)-4-bromo-N-tert-butylsulfanyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane.
| Compound Name | (2E)-4-bromo-N-tert-butylsulfanyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 171086406 |
| Molecular Formula | C14H26BrNS |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2E)-4-bromo-N-tert-butylsulfanyl-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-amine;ethane |
| SMILES | C=C(Br)/C=C(\C=C/C)CNSC(C)(C)C.CC |
| InChI | InChI=1S/C12H20BrNS.C2H6/c1-6-7-11(8-10(2)13)9-14-15-12(3,4)5;1-2/h6-8,14H,2,9H2,1,3-5H3;1-2H3/b7-6-,11-8+; |
| InChIKey | MIBBBTUYPBVKCO-DWROGWBBSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|