C18H30S — CID 134232876
(3E,5Z)-3-tert-butyl-4-(2-tert-butylsulfanylprop-2-enyl)hepta-1,3,5-triene (PubChem CID 134232876) has the molecular formula C18H30S and a molecular weight of 278.51 g/mol. Its IUPAC name is (3E,5Z)-3-tert-butyl-4-(2-tert-butylsulfanylprop-2-enyl)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-tert-butyl-4-(2-tert-butylsulfanylprop-2-enyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 134232876 |
| Molecular Formula | C18H30S |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3E,5Z)-3-tert-butyl-4-(2-tert-butylsulfanylprop-2-enyl)hepta-1,3,5-triene |
| SMILES | C=C/C(=C(\C=C/C)CC(=C)SC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30S/c1-10-12-15(16(11-2)17(4,5)6)13-14(3)19-18(7,8)9/h10-12H,2-3,13H2,1,4-9H3/b12-10-,16-15- |
| InChIKey | UXGWKYWWCIUHJJ-LYZHNOTLSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|