C14H24S — CID 123259234
2-tert-butylsulfanyl-6,6-dimethyl-5-methylidenehepta-1,3-diene (PubChem CID 123259234) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-6,6-dimethyl-5-methylidenehepta-1,3-diene.
| Compound Name | 2-tert-butylsulfanyl-6,6-dimethyl-5-methylidenehepta-1,3-diene |
|---|---|
| PubChem CID | 123259234 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-tert-butylsulfanyl-6,6-dimethyl-5-methylidenehepta-1,3-diene |
| SMILES | C=C(C=CC(=C)C(C)(C)C)SC(C)(C)C |
| InChI | InChI=1S/C14H24S/c1-11(13(3,4)5)9-10-12(2)15-14(6,7)8/h9-10H,1-2H2,3-8H3 |
| InChIKey | MHFKKWMWZLRTPM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|