C10H16BrN — CID 155442209
(2E,5Z)-2-bromo-N-ethyl-4-methylidenehepta-2,5-dien-1-amine (PubChem CID 155442209) has the molecular formula C10H16BrN and a molecular weight of 230.15 g/mol. Its IUPAC name is (2E,5Z)-2-bromo-N-ethyl-4-methylidenehepta-2,5-dien-1-amine.
| Compound Name | (2E,5Z)-2-bromo-N-ethyl-4-methylidenehepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 155442209 |
| Molecular Formula | C10H16BrN |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2E,5Z)-2-bromo-N-ethyl-4-methylidenehepta-2,5-dien-1-amine |
| SMILES | C=C(/C=C\C)/C=C(/Br)CNCC |
| InChI | InChI=1S/C10H16BrN/c1-4-6-9(3)7-10(11)8-12-5-2/h4,6-7,12H,3,5,8H2,1-2H3/b6-4-,10-7+ |
| InChIKey | QULFXGIMFOGKAM-BSAFSDHNSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|