About ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol
ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol (PubChem CID 143707502) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol.
Molecular Properties
| Compound Name | ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol |
| PubChem CID | 143707502 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol |
| SMILES | C/C=C(\C)CNCC.C=CN.CO |
| InChI | InChI=1S/C7H15N.C2H5N.CH4O/c1-4-7(3)6-8-5-2;1-2-3;1-2/h4,8H,5-6H2,1-3H3;2H,1,3H2;2H,1H3/b7-4+;; |
| InChIKey | WBCCJQSSRLYGPT-RDRKJGRWSA-N |
| XLogP | 1.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol?
The IUPAC name of ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol (CID 143707502) is ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol.
What is the SMILES notation for ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol?
The canonical SMILES for ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol is C/C=C(\C)CNCC.C=CN.CO.
What is the InChIKey of ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol?
The InChIKey is WBCCJQSSRLYGPT-RDRKJGRWSA-N. The full InChI is InChI=1S/C7H15N.C2H5N.CH4O/c1-4-7(3)6-8-5-2;1-2-3;1-2/h4,8H,5-6H2,1-3H3;2H,1,3H2;2H,1H3/b7-4+;;.
What are the key properties of ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol?
ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol has a molecular weight of 188.31 g/mol, XLogP of 1.26, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;(E)-N-ethyl-2-methylbut-2-en-1-amine;methanol is sourced from PubChem (CID 143707502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).