C32H55N — CID 87373466
(6E,10E,14E,18E)-N-ethyl-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-amine (PubChem CID 87373466) has the molecular formula C32H55N and a molecular weight of 453.80 g/mol. Its IUPAC name is (6E,10E,14E,18E)-N-ethyl-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-amine.
| Compound Name | (6E,10E,14E,18E)-N-ethyl-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-amine |
|---|---|
| PubChem CID | 87373466 |
| Molecular Formula | C32H55N |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.43 |
| IUPAC Name | (6E,10E,14E,18E)-N-ethyl-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-amine |
| SMILES | CCNCC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H55N/c1-9-33-26-32(8)25-15-24-31(7)23-14-21-29(5)18-11-10-17-28(4)20-13-22-30(6)19-12-16-27(2)3/h16-18,22-23,25,33H,9-15,19-21,24,26H2,1-8H3/b28-17+,29-18+,30-22+,31-23+,32-25? |
| InChIKey | ZPFWSSZNPUZEDI-YJJVGNBWSA-N |
| XLogP | 10.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|