C15H26 — CID 156738018
(2Z,4Z)-3-methyl-6-methylidene-7-propan-2-yldeca-2,4-diene (PubChem CID 156738018) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (2Z,4Z)-3-methyl-6-methylidene-7-propan-2-yldeca-2,4-diene.
| Compound Name | (2Z,4Z)-3-methyl-6-methylidene-7-propan-2-yldeca-2,4-diene |
|---|---|
| PubChem CID | 156738018 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (2Z,4Z)-3-methyl-6-methylidene-7-propan-2-yldeca-2,4-diene |
| SMILES | C=C(/C=C\C(C)=C/C)C(CCC)C(C)C |
| InChI | InChI=1S/C15H26/c1-7-9-15(12(3)4)14(6)11-10-13(5)8-2/h8,10-12,15H,6-7,9H2,1-5H3/b11-10-,13-8- |
| InChIKey | PPWUUDQVDVLVIS-LCIDHMNGSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|