C19H35N — CID 176983702
ethane;1-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]-4-propan-2-ylpiperidine (PubChem CID 176983702) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]-4-propan-2-ylpiperidine.
| Compound Name | ethane;1-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 176983702 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | ethane;1-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]-4-propan-2-ylpiperidine |
| SMILES | C=C(/C=C\C(C)=C/C)CN1CCC(C(C)C)CC1.CC |
| InChI | InChI=1S/C17H29N.C2H6/c1-6-15(4)7-8-16(5)13-18-11-9-17(10-12-18)14(2)3;1-2/h6-8,14,17H,5,9-13H2,1-4H3;1-2H3/b8-7-,15-6-; |
| InChIKey | OLWDWLNBZXYPBX-OHBIQMCWSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|