C16H24 — CID 123823855
3,6-dimethyl-7-methylidenetrideca-2,4,8,10-tetraene (PubChem CID 123823855) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 3,6-dimethyl-7-methylidenetrideca-2,4,8,10-tetraene.
| Compound Name | 3,6-dimethyl-7-methylidenetrideca-2,4,8,10-tetraene |
|---|---|
| PubChem CID | 123823855 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 3,6-dimethyl-7-methylidenetrideca-2,4,8,10-tetraene |
| SMILES | C=C(C=CC=CCC)C(C)C=CC(C)=CC |
| InChI | InChI=1S/C16H24/c1-6-8-9-10-11-15(4)16(5)13-12-14(3)7-2/h7-13,16H,4,6H2,1-3,5H3 |
| InChIKey | SWKOBUMBFRMWRX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|