C16H25NO — CID 143484663
(3Z,5Z)-N-[(3Z,5Z)-hepta-3,5-dienyl]-2,5-dimethylhepta-3,5-dienamide (PubChem CID 143484663) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3Z,5Z)-N-[(3Z,5Z)-hepta-3,5-dienyl]-2,5-dimethylhepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[(3Z,5Z)-hepta-3,5-dienyl]-2,5-dimethylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143484663 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3Z,5Z)-N-[(3Z,5Z)-hepta-3,5-dienyl]-2,5-dimethylhepta-3,5-dienamide |
| SMILES | C/C=C\C=C/CCNC(=O)C(C)/C=C\C(C)=C/C |
| InChI | InChI=1S/C16H25NO/c1-5-7-8-9-10-13-17-16(18)15(4)12-11-14(3)6-2/h5-9,11-12,15H,10,13H2,1-4H3,(H,17,18)/b7-5-,9-8-,12-11-,14-6- |
| InChIKey | YILDKYVFFSAAIM-AZAQQWCXSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|