C13H21NO — CID 87311173
(2E,6E,8E)-N-propan-2-yldeca-2,6,8-trienamide (PubChem CID 87311173) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E,6E,8E)-N-propan-2-yldeca-2,6,8-trienamide.
| Compound Name | (2E,6E,8E)-N-propan-2-yldeca-2,6,8-trienamide |
|---|---|
| PubChem CID | 87311173 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2E,6E,8E)-N-propan-2-yldeca-2,6,8-trienamide |
| SMILES | C/C=C/C=C/CC/C=C/C(=O)NC(C)C |
| InChI | InChI=1S/C13H21NO/c1-4-5-6-7-8-9-10-11-13(15)14-12(2)3/h4-7,10-12H,8-9H2,1-3H3,(H,14,15)/b5-4+,7-6+,11-10+ |
| InChIKey | PJRULOCMIKXLNU-RXTMUMTRSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|