C9H16INO — CID 139665458
6-iodo-N-propan-2-ylhex-2-enamide (PubChem CID 139665458) has the molecular formula C9H16INO and a molecular weight of 281.14 g/mol. Its IUPAC name is 6-iodo-N-propan-2-ylhex-2-enamide.
| Compound Name | 6-iodo-N-propan-2-ylhex-2-enamide |
|---|---|
| PubChem CID | 139665458 |
| Molecular Formula | C9H16INO |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 6-iodo-N-propan-2-ylhex-2-enamide |
| SMILES | CC(C)NC(=O)C=CCCCI |
| InChI | InChI=1S/C9H16INO/c1-8(2)11-9(12)6-4-3-5-7-10/h4,6,8H,3,5,7H2,1-2H3,(H,11,12) |
| InChIKey | FMPFFQAGMBOVBC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|