C22H41N3O2 — CID 102116504
(E)-N-[1-[2-[[(E)-oct-2-enoyl]amino]propylamino]propan-2-yl]oct-2-enamide (PubChem CID 102116504) has the molecular formula C22H41N3O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is (E)-N-[1-[2-[[(E)-oct-2-enoyl]amino]propylamino]propan-2-yl]oct-2-enamide.
| Compound Name | (E)-N-[1-[2-[[(E)-oct-2-enoyl]amino]propylamino]propan-2-yl]oct-2-enamide |
|---|---|
| PubChem CID | 102116504 |
| Molecular Formula | C22H41N3O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | (E)-N-[1-[2-[[(E)-oct-2-enoyl]amino]propylamino]propan-2-yl]oct-2-enamide |
| SMILES | CCCCC/C=C/C(=O)NC(C)CNCC(C)NC(=O)/C=C/CCCCC |
| InChI | InChI=1S/C22H41N3O2/c1-5-7-9-11-13-15-21(26)24-19(3)17-23-18-20(4)25-22(27)16-14-12-10-8-6-2/h13-16,19-20,23H,5-12,17-18H2,1-4H3,(H,24,26)(H,25,27)/b15-13+,16-14+ |
| InChIKey | XBMUSHLXOARGQQ-WXUKJITCSA-N |
| XLogP | 3.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|