C27H51N3O3 — CID 101285823
(E)-N-[1-[3-hydroxypropyl-[2-[[(E)-non-2-enoyl]amino]propyl]amino]propan-2-yl]non-2-enamide (PubChem CID 101285823) has the molecular formula C27H51N3O3 and a molecular weight of 465.72 g/mol. Its IUPAC name is (E)-N-[1-[3-hydroxypropyl-[2-[[(E)-non-2-enoyl]amino]propyl]amino]propan-2-yl]non-2-enamide.
| Compound Name | (E)-N-[1-[3-hydroxypropyl-[2-[[(E)-non-2-enoyl]amino]propyl]amino]propan-2-yl]non-2-enamide |
|---|---|
| PubChem CID | 101285823 |
| Molecular Formula | C27H51N3O3 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.39 |
| IUPAC Name | (E)-N-[1-[3-hydroxypropyl-[2-[[(E)-non-2-enoyl]amino]propyl]amino]propan-2-yl]non-2-enamide |
| SMILES | CCCCCC/C=C/C(=O)NC(C)CN(CCCO)CC(C)NC(=O)/C=C/CCCCCC |
| InChI | InChI=1S/C27H51N3O3/c1-5-7-9-11-13-15-18-26(32)28-24(3)22-30(20-17-21-31)23-25(4)29-27(33)19-16-14-12-10-8-6-2/h15-16,18-19,24-25,31H,5-14,17,20-23H2,1-4H3,(H,28,32)(H,29,33)/b18-15+,19-16+ |
| InChIKey | SGWMHFKNEQGWJV-GTLAIDDRSA-N |
| XLogP | 4.73 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|