C24H40CaN2O6 — CID 101276410
calcium;3-[[(E)-oct-2-enoyl]amino]butanoic acid;3-[[(E)-1-oxidooct-2-enylidene]amino]butanoate (PubChem CID 101276410) has the molecular formula C24H40CaN2O6 and a molecular weight of 492.67 g/mol. Its IUPAC name is calcium;3-[[(E)-oct-2-enoyl]amino]butanoic acid;3-[[(E)-1-oxidooct-2-enylidene]amino]butanoate.
| Compound Name | calcium;3-[[(E)-oct-2-enoyl]amino]butanoic acid;3-[[(E)-1-oxidooct-2-enylidene]amino]butanoate |
|---|---|
| PubChem CID | 101276410 |
| Molecular Formula | C24H40CaN2O6 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | calcium;3-[[(E)-oct-2-enoyl]amino]butanoic acid;3-[[(E)-1-oxidooct-2-enylidene]amino]butanoate |
| SMILES | CCCCC/C=C/C(=O)NC(C)CC(=O)O.CCCCC/C=C/C([O-])=N/C(C)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C12H21NO3.Ca/c2*1-3-4-5-6-7-8-11(14)13-10(2)9-12(15)16;/h2*7-8,10H,3-6,9H2,1-2H3,(H,13,14)(H,15,16);/q;;+2/p-2/b2*8-7+; |
| InChIKey | CDIYWRGZBMIZBV-ORWWTJHYSA-L |
| XLogP | 2.13 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|