C24H33NNa2O5 — CID 139685385
disodium;(2S)-2-(icosa-2,4,6,8,10-pentaenoylamino)butanedioate (PubChem CID 139685385) has the molecular formula C24H33NNa2O5 and a molecular weight of 461.51 g/mol. Its IUPAC name is disodium;(2S)-2-(icosa-2,4,6,8,10-pentaenoylamino)butanedioate.
| Compound Name | disodium;(2S)-2-(icosa-2,4,6,8,10-pentaenoylamino)butanedioate |
|---|---|
| PubChem CID | 139685385 |
| Molecular Formula | C24H33NNa2O5 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | disodium;(2S)-2-(icosa-2,4,6,8,10-pentaenoylamino)butanedioate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C24H35NO5.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)25-21(24(29)30)20-23(27)28;;/h10-19,21H,2-9,20H2,1H3,(H,25,26)(H,27,28)(H,29,30);;/q;2*+1/p-2/t21-;;/m0../s1 |
| InChIKey | OCUBKNJOOXXXAW-FGJQBABTSA-L |
| XLogP | -3.71 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|