C28H43NO3 — CID 175400234
2-(docosa-2,4,6,8,10,12-hexaenoylamino)-4-methylpentanoic acid (PubChem CID 175400234) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-(docosa-2,4,6,8,10,12-hexaenoylamino)-4-methylpentanoic acid.
| Compound Name | 2-(docosa-2,4,6,8,10,12-hexaenoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175400234 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 2-(docosa-2,4,6,8,10,12-hexaenoylamino)-4-methylpentanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C28H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(30)29-26(28(31)32)24-25(2)3/h12-23,25-26H,4-11,24H2,1-3H3,(H,29,30)(H,31,32) |
| InChIKey | CLCRWFPALYJWPM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|