C11H21N — CID 156711872
(2E,4Z)-6-methyldeca-2,4-dien-3-amine (PubChem CID 156711872) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (2E,4Z)-6-methyldeca-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-6-methyldeca-2,4-dien-3-amine |
|---|---|
| PubChem CID | 156711872 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (2E,4Z)-6-methyldeca-2,4-dien-3-amine |
| SMILES | C/C=C(N)\C=C/C(C)CCCC |
| InChI | InChI=1S/C11H21N/c1-4-6-7-10(3)8-9-11(12)5-2/h5,8-10H,4,6-7,12H2,1-3H3/b9-8-,11-5+ |
| InChIKey | IQFMVEOQRMABRV-IMDCMVKOSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|