C10H18O — CID 145221921
(1E,3E)-5-methylnona-1,3-dien-1-ol (PubChem CID 145221921) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (1E,3E)-5-methylnona-1,3-dien-1-ol.
| Compound Name | (1E,3E)-5-methylnona-1,3-dien-1-ol |
|---|---|
| PubChem CID | 145221921 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (1E,3E)-5-methylnona-1,3-dien-1-ol |
| SMILES | CCCCC(C)/C=C/C=C/O |
| InChI | InChI=1S/C10H18O/c1-3-4-7-10(2)8-5-6-9-11/h5-6,8-11H,3-4,7H2,1-2H3/b8-5+,9-6+ |
| InChIKey | HCYBLCDEEGXUQM-XVYDYJIPSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|