C30H49NS — CID 145235020
(4Z,8Z,12Z)-8-ethyl-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;N-methyl-N-methylsulfanylmethanamine;propane (PubChem CID 145235020) has the molecular formula C30H49NS and a molecular weight of 455.80 g/mol. Its IUPAC name is (4Z,8Z,12Z)-8-ethyl-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;N-methyl-N-methylsulfanylmethanamine;propane.
| Compound Name | (4Z,8Z,12Z)-8-ethyl-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;N-methyl-N-methylsulfanylmethanamine;propane |
|---|---|
| PubChem CID | 145235020 |
| Molecular Formula | C30H49NS |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | (4Z,8Z,12Z)-8-ethyl-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;N-methyl-N-methylsulfanylmethanamine;propane |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C\C(=C)CC)CC.CCC.CSN(C)C |
| InChI | InChI=1S/C24H32.C3H9NS.C3H8/c1-10-18(4)13-15-20(6)22(8)17-24(12-3)23(9)21(7)16-14-19(5)11-2;1-4(2)5-3;1-3-2/h13-17H,4-12H2,1-3H3;1-3H3;3H2,1-2H3/b15-13-,16-14-,24-17-;; |
| InChIKey | FURRVUPUBPFBHZ-VZCJELSHSA-N |
| XLogP | 9.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|