C14H30ClNO3 — CID 162120972
butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride (PubChem CID 162120972) has the molecular formula C14H30ClNO3 and a molecular weight of 295.85 g/mol. Its IUPAC name is butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride.
| Compound Name | butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride |
|---|---|
| PubChem CID | 162120972 |
| Molecular Formula | C14H30ClNO3 |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride |
| SMILES | CCCCOC(=O)C[C@@H](OC)[C@@H](NC)[C@@H](C)CC.Cl |
| InChI | InChI=1S/C14H29NO3.ClH/c1-6-8-9-18-13(16)10-12(17-5)14(15-4)11(3)7-2;/h11-12,14-15H,6-10H2,1-5H3;1H/t11-,12+,14-;/m0./s1 |
| InChIKey | ZHJZLQSKTXXLLH-BMZHGHOISA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|