C12H26O4 — CID 59693568
(3S,4R,5S,6R)-3,4,5,6-tetramethoxyoctane (PubChem CID 59693568) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3S,4R,5S,6R)-3,4,5,6-tetramethoxyoctane.
| Compound Name | (3S,4R,5S,6R)-3,4,5,6-tetramethoxyoctane |
|---|---|
| PubChem CID | 59693568 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (3S,4R,5S,6R)-3,4,5,6-tetramethoxyoctane |
| SMILES | CC[C@H](OC)[C@@H](OC)[C@@H](OC)[C@@H](CC)OC |
| InChI | InChI=1S/C12H26O4/c1-7-9(13-3)11(15-5)12(16-6)10(8-2)14-4/h9-12H,7-8H2,1-6H3/t9-,10+,11+,12- |
| InChIKey | YWOYYMZXJNLUEN-IWDIQUIJSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |