C7H17NO — CID 124510675
(2S,3R)-2-methoxy-3-methylpentan-1-amine (PubChem CID 124510675) has the molecular formula C7H17NO and a molecular weight of 131.22 g/mol. Its IUPAC name is (2S,3R)-2-methoxy-3-methylpentan-1-amine.
| Compound Name | (2S,3R)-2-methoxy-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 124510675 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | (2S,3R)-2-methoxy-3-methylpentan-1-amine |
| SMILES | CC[C@@H](C)[C@@H](CN)OC |
| InChI | InChI=1S/C7H17NO/c1-4-6(2)7(5-8)9-3/h6-7H,4-5,8H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | IDMUEQYNTNCGJN-RNFRBKRXSA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |