C7H17NO2 — CID 116503390
2,4-dimethoxy-3-methylbutan-1-amine (PubChem CID 116503390) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,4-dimethoxy-3-methylbutan-1-amine.
| Compound Name | 2,4-dimethoxy-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 116503390 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2,4-dimethoxy-3-methylbutan-1-amine |
| SMILES | COCC(C)C(CN)OC |
| InChI | InChI=1S/C7H17NO2/c1-6(5-9-2)7(4-8)10-3/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | ARGITOXEYRPKEV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |