C6H15NO3 — CID 23120503
2,3,3-trimethoxypropan-1-amine (PubChem CID 23120503) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is 2,3,3-trimethoxypropan-1-amine.
| Compound Name | 2,3,3-trimethoxypropan-1-amine |
|---|---|
| PubChem CID | 23120503 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 2,3,3-trimethoxypropan-1-amine |
| SMILES | COC(CN)C(OC)OC |
| InChI | InChI=1S/C6H15NO3/c1-8-5(4-7)6(9-2)10-3/h5-6H,4,7H2,1-3H3 |
| InChIKey | KBURGWUJBARVIE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|