C6H16N2O — CID 131111146
3-methoxypentane-1,2-diamine (PubChem CID 131111146) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is 3-methoxypentane-1,2-diamine.
| Compound Name | 3-methoxypentane-1,2-diamine |
|---|---|
| PubChem CID | 131111146 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 3-methoxypentane-1,2-diamine |
| SMILES | CCC(OC)C(N)CN |
| InChI | InChI=1S/C6H16N2O/c1-3-6(9-2)5(8)4-7/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | YZXIJZZJIXBBQR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |