C7H15NO3 — CID 163864356
2,3-dimethoxy-1-nitrosopentane (PubChem CID 163864356) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is 2,3-dimethoxy-1-nitrosopentane.
| Compound Name | 2,3-dimethoxy-1-nitrosopentane |
|---|---|
| PubChem CID | 163864356 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 2,3-dimethoxy-1-nitrosopentane |
| SMILES | CCC(OC)C(CN=O)OC |
| InChI | InChI=1S/C7H15NO3/c1-4-6(10-2)7(11-3)5-8-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | PFIMVGJMAGZKAA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |