C12H25IO3 — CID 146498069
(2R,3S)-1-iodo-1-methoxy-2-methyl-3,4-di(propan-2-yloxy)butane (PubChem CID 146498069) has the molecular formula C12H25IO3 and a molecular weight of 344.23 g/mol. Its IUPAC name is (2R,3S)-1-iodo-1-methoxy-2-methyl-3,4-di(propan-2-yloxy)butane.
| Compound Name | (2R,3S)-1-iodo-1-methoxy-2-methyl-3,4-di(propan-2-yloxy)butane |
|---|---|
| PubChem CID | 146498069 |
| Molecular Formula | C12H25IO3 |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2R,3S)-1-iodo-1-methoxy-2-methyl-3,4-di(propan-2-yloxy)butane |
| SMILES | COC(I)[C@H](C)[C@@H](COC(C)C)OC(C)C |
| InChI | InChI=1S/C12H25IO3/c1-8(2)15-7-11(16-9(3)4)10(5)12(13)14-6/h8-12H,7H2,1-6H3/t10-,11-,12?/m1/s1 |
| InChIKey | TVKPENJEBFSSDX-XFKKCKKNSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|