About 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine
5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine (PubChem CID 81101856) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine |
| PubChem CID | 81101856 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine |
| SMILES | COCCCC(N)CN(C)C |
| InChI | InChI=1S/C8H20N2O/c1-10(2)7-8(9)5-4-6-11-3/h8H,4-7,9H2,1-3H3 |
| InChIKey | VARRLYOTVWEFRF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine?
The IUPAC name of 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine (CID 81101856) is 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine.
What is the SMILES notation for 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine?
The canonical SMILES for 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine is COCCCC(N)CN(C)C.
What is the InChIKey of 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine?
The InChIKey is VARRLYOTVWEFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O/c1-10(2)7-8(9)5-4-6-11-3/h8H,4-7,9H2,1-3H3.
What are the key properties of 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine?
5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine has a molecular weight of 160.26 g/mol, XLogP of 0.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-N,1-N-dimethylpentane-1,2-diamine is sourced from PubChem (CID 81101856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).