C8H21N3O — CID 105244836
2-hydrazinyl-5-methoxy-N,N-dimethylpentan-1-amine (PubChem CID 105244836) has the molecular formula C8H21N3O and a molecular weight of 175.28 g/mol. Its IUPAC name is 2-hydrazinyl-5-methoxy-N,N-dimethylpentan-1-amine.
| Compound Name | 2-hydrazinyl-5-methoxy-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 105244836 |
| Molecular Formula | C8H21N3O |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.17 |
| IUPAC Name | 2-hydrazinyl-5-methoxy-N,N-dimethylpentan-1-amine |
| SMILES | COCCCC(CN(C)C)NN |
| InChI | InChI=1S/C8H21N3O/c1-11(2)7-8(10-9)5-4-6-12-3/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | URQAEZZDUUJRIL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|