C13H30N2O — CID 62475448
4-methoxy-1-N,1-N-bis(2-methylpropyl)butane-1,2-diamine (PubChem CID 62475448) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 4-methoxy-1-N,1-N-bis(2-methylpropyl)butane-1,2-diamine.
| Compound Name | 4-methoxy-1-N,1-N-bis(2-methylpropyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 62475448 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 4-methoxy-1-N,1-N-bis(2-methylpropyl)butane-1,2-diamine |
| SMILES | COCCC(N)CN(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H30N2O/c1-11(2)8-15(9-12(3)4)10-13(14)6-7-16-5/h11-13H,6-10,14H2,1-5H3 |
| InChIKey | BOAGUQFTWOEGBJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |