About 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine
3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine (PubChem CID 81101510) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine |
| PubChem CID | 81101510 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine |
| SMILES | COCC(N)CN(CC(C)C)CC(C)C |
| InChI | InChI=1S/C12H28N2O/c1-10(2)6-14(7-11(3)4)8-12(13)9-15-5/h10-12H,6-9,13H2,1-5H3 |
| InChIKey | KJNHUECBQNAXIV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine?
The IUPAC name of 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine (CID 81101510) is 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine.
What is the SMILES notation for 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine?
The canonical SMILES for 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine is COCC(N)CN(CC(C)C)CC(C)C.
What is the InChIKey of 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine?
The InChIKey is KJNHUECBQNAXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O/c1-10(2)6-14(7-11(3)4)8-12(13)9-15-5/h10-12H,6-9,13H2,1-5H3.
What are the key properties of 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine?
3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine has a molecular weight of 216.37 g/mol, XLogP of 1.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1-N,1-N-bis(2-methylpropyl)propane-1,2-diamine is sourced from PubChem (CID 81101510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).