C7H17NO — CID 177282039
(2R)-3,3-dideuterio-1-methoxy-4-methylpentan-2-amine (PubChem CID 177282039) has the molecular formula C7H17NO and a molecular weight of 133.23 g/mol. Its IUPAC name is (2R)-3,3-dideuterio-1-methoxy-4-methylpentan-2-amine.
| Compound Name | (2R)-3,3-dideuterio-1-methoxy-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 177282039 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 133.23 g/mol |
| Exact Mass | 133.14 |
| IUPAC Name | (2R)-3,3-dideuterio-1-methoxy-4-methylpentan-2-amine |
| SMILES | [2H]C([2H])(C(C)C)[C@@H](N)COC |
| InChI | InChI=1S/C7H17NO/c1-6(2)4-7(8)5-9-3/h6-7H,4-5,8H2,1-3H3/t7-/m1/s1/i4D2 |
| InChIKey | CMMWLDUVRGBDBR-OYNDKXPVSA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |