About 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine
1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine (PubChem CID 63761505) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine.
Analyze 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine?
The IUPAC name of 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine (CID 63761505) is 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine.
What is the SMILES notation for 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine?
The canonical SMILES for 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine is CCC(C)N(C)CC(N)COC.
What is the InChIKey of 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine?
The InChIKey is FAWNZAWEGIUGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-5-8(2)11(3)6-9(10)7-12-4/h8-9H,5-7,10H2,1-4H3.
What are the key properties of 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine?
1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine has a molecular weight of 174.29 g/mol, XLogP of 0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-butan-2-yl-3-methoxy-1-N-methylpropane-1,2-diamine is sourced from PubChem (CID 63761505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).