C9H21NO2 — CID 66223820
N-(2,2-dimethoxyethyl)-N-methylbutan-2-amine (PubChem CID 66223820) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methylbutan-2-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 66223820 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methylbutan-2-amine |
| SMILES | CCC(C)N(C)CC(OC)OC |
| InChI | InChI=1S/C9H21NO2/c1-6-8(2)10(3)7-9(11-4)12-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | LEWQTSDWDFEFLJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|