C8H13N3O2 — CID 66222758
2-[cyanomethyl(2,2-dimethoxyethyl)amino]acetonitrile (PubChem CID 66222758) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-[cyanomethyl(2,2-dimethoxyethyl)amino]acetonitrile.
| Compound Name | 2-[cyanomethyl(2,2-dimethoxyethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 66222758 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[cyanomethyl(2,2-dimethoxyethyl)amino]acetonitrile |
| SMILES | COC(CN(CC#N)CC#N)OC |
| InChI | InChI=1S/C8H13N3O2/c1-12-8(13-2)7-11(5-3-9)6-4-10/h8H,5-7H2,1-2H3 |
| InChIKey | JNJQIIOOGMASMX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|