C12H27N3O2 — CID 63761507
2-[(2-amino-3-methoxypropyl)-methylamino]-N-tert-butylpropanamide (PubChem CID 63761507) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-[(2-amino-3-methoxypropyl)-methylamino]-N-tert-butylpropanamide.
| Compound Name | 2-[(2-amino-3-methoxypropyl)-methylamino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 63761507 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-[(2-amino-3-methoxypropyl)-methylamino]-N-tert-butylpropanamide |
| SMILES | COCC(N)CN(C)C(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H27N3O2/c1-9(11(16)14-12(2,3)4)15(5)7-10(13)8-17-6/h9-10H,7-8,13H2,1-6H3,(H,14,16) |
| InChIKey | KOAREWLQCHFALO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |