C12H24N2O3 — CID 62012945
ethyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate (PubChem CID 62012945) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate.
| Compound Name | ethyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 62012945 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-7-17-10(15)8-14(6)9(2)11(16)13-12(3,4)5/h9H,7-8H2,1-6H3,(H,13,16) |
| InChIKey | XDAPZVJCOVLAJL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |