C12H30AlN — CID 158194503
alumane;2-methyl-N,N-bis(2-methylpropyl)propan-1-amine (PubChem CID 158194503) has the molecular formula C12H30AlN and a molecular weight of 215.36 g/mol. Its IUPAC name is alumane;2-methyl-N,N-bis(2-methylpropyl)propan-1-amine.
| Compound Name | alumane;2-methyl-N,N-bis(2-methylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 158194503 |
| Molecular Formula | C12H30AlN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | alumane;2-methyl-N,N-bis(2-methylpropyl)propan-1-amine |
| SMILES | CC(C)CN(CC(C)C)CC(C)C.[AlH3] |
| InChI | InChI=1S/C12H27N.Al.3H/c1-10(2)7-13(8-11(3)4)9-12(5)6;;;;/h10-12H,7-9H2,1-6H3;;;; |
| InChIKey | GAEFQKOVYSCZAV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |