C18H40N2 — CID 18709992
N,N,N',N'-tetrakis(2-methylpropyl)ethane-1,2-diamine (PubChem CID 18709992) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18709992 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N,N,N',N'-tetrakis(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN(CC(C)C)CC(C)C)CC(C)C |
| InChI | InChI=1S/C18H40N2/c1-15(2)11-19(12-16(3)4)9-10-20(13-17(5)6)14-18(7)8/h15-18H,9-14H2,1-8H3 |
| InChIKey | KZGORJUPSSNLAT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |