C11H17NO — CID 116909513
dimethylamino-(2,5-dimethylphenyl)methanol (PubChem CID 116909513) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is dimethylamino-(2,5-dimethylphenyl)methanol.
| Compound Name | dimethylamino-(2,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 116909513 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | dimethylamino-(2,5-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C)c(C(O)N(C)C)c1 |
| InChI | InChI=1S/C11H17NO/c1-8-5-6-9(2)10(7-8)11(13)12(3)4/h5-7,11,13H,1-4H3 |
| InChIKey | HCYBRXWVYNMTKT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|