C13H16Cl2F3NO — CID 63827650
1-(2,4-dichlorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine (PubChem CID 63827650) has the molecular formula C13H16Cl2F3NO and a molecular weight of 330.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63827650 |
| Molecular Formula | C13H16Cl2F3NO |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine |
| SMILES | CCC(NCCOCC(F)(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2F3NO/c1-2-12(10-4-3-9(14)7-11(10)15)19-5-6-20-8-13(16,17)18/h3-4,7,12,19H,2,5-6,8H2,1H3 |
| InChIKey | PLFDXPWDWVULKV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|