C15H24Cl2N2O — CID 107094120
1-(2,4-dichlorophenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]propan-1-amine (PubChem CID 107094120) has the molecular formula C15H24Cl2N2O and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]propan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107094120 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]propan-1-amine |
| SMILES | CCC(NCCOCCN(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H24Cl2N2O/c1-4-15(13-6-5-12(16)11-14(13)17)18-7-9-20-10-8-19(2)3/h5-6,11,15,18H,4,7-10H2,1-3H3 |
| InChIKey | CBMSZBZDPAZUML-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|